C18H13F3N2O3 — CID 155813475
4-[4-(hydroxymethyl)-3-[3-(trifluoromethyl)phenyl]pyrazol-1-yl]benzoic acid (PubChem CID 155813475) has the molecular formula C18H13F3N2O3 and a molecular weight of 362.31 g/mol. Its IUPAC name is 4-[4-(hydroxymethyl)-3-[3-(trifluoromethyl)phenyl]pyrazol-1-yl]benzoic acid.
| Compound Name | 4-[4-(hydroxymethyl)-3-[3-(trifluoromethyl)phenyl]pyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 155813475 |
| Molecular Formula | C18H13F3N2O3 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 4-[4-(hydroxymethyl)-3-[3-(trifluoromethyl)phenyl]pyrazol-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-n2cc(CO)c(-c3cccc(C(F)(F)F)c3)n2)cc1 |
| InChI | InChI=1S/C18H13F3N2O3/c19-18(20,21)14-3-1-2-12(8-14)16-13(10-24)9-23(22-16)15-6-4-11(5-7-15)17(25)26/h1-9,24H,10H2,(H,25,26) |
| InChIKey | QDANGIRPLWBBRT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |