C16H11N3S — CID 155813842
8-methyl-2-phenyl-[1,3]thiazolo[5,4-h][1,6]naphthyridine (PubChem CID 155813842) has the molecular formula C16H11N3S and a molecular weight of 277.35 g/mol. Its IUPAC name is 8-methyl-2-phenyl-[1,3]thiazolo[5,4-h][1,6]naphthyridine.
| Compound Name | 8-methyl-2-phenyl-[1,3]thiazolo[5,4-h][1,6]naphthyridine |
|---|---|
| PubChem CID | 155813842 |
| Molecular Formula | C16H11N3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 8-methyl-2-phenyl-[1,3]thiazolo[5,4-h][1,6]naphthyridine |
| SMILES | Cc1ccc2cnc3sc(-c4ccccc4)nc3c2n1 |
| InChI | InChI=1S/C16H11N3S/c1-10-7-8-12-9-17-16-14(13(12)18-10)19-15(20-16)11-5-3-2-4-6-11/h2-9H,1H3 |
| InChIKey | DKPBZRVXYTWTBD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |