C18H11F4N3O2 — CID 155814719
4-fluoro-N-[4-[3-(trifluoromethyl)phenoxy]pyrimidin-5-yl]benzamide (PubChem CID 155814719) has the molecular formula C18H11F4N3O2 and a molecular weight of 377.30 g/mol. Its IUPAC name is 4-fluoro-N-[4-[3-(trifluoromethyl)phenoxy]pyrimidin-5-yl]benzamide.
| Compound Name | 4-fluoro-N-[4-[3-(trifluoromethyl)phenoxy]pyrimidin-5-yl]benzamide |
|---|---|
| PubChem CID | 155814719 |
| Molecular Formula | C18H11F4N3O2 |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 4-fluoro-N-[4-[3-(trifluoromethyl)phenoxy]pyrimidin-5-yl]benzamide |
| SMILES | O=C(Nc1cncnc1Oc1cccc(C(F)(F)F)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H11F4N3O2/c19-13-6-4-11(5-7-13)16(26)25-15-9-23-10-24-17(15)27-14-3-1-2-12(8-14)18(20,21)22/h1-10H,(H,25,26) |
| InChIKey | LZZNLUAFEBWFSS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |