C22H21Cl4NO6 — CID 155815172
2,2-dichloro-N-(2,2-dichloroacetyl)-N-[2,6-dimethoxy-3-(4-methoxy-3,5-dimethylbenzoyl)phenyl]acetamide (PubChem CID 155815172) has the molecular formula C22H21Cl4NO6 and a molecular weight of 537.22 g/mol. Its IUPAC name is 2,2-dichloro-N-(2,2-dichloroacetyl)-N-[2,6-dimethoxy-3-(4-methoxy-3,5-dimethylbenzoyl)phenyl]acetamide.
| Compound Name | 2,2-dichloro-N-(2,2-dichloroacetyl)-N-[2,6-dimethoxy-3-(4-methoxy-3,5-dimethylbenzoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 155815172 |
| Molecular Formula | C22H21Cl4NO6 |
| Molecular Weight | 537.22 g/mol |
| Exact Mass | 535.01 |
| IUPAC Name | 2,2-dichloro-N-(2,2-dichloroacetyl)-N-[2,6-dimethoxy-3-(4-methoxy-3,5-dimethylbenzoyl)phenyl]acetamide |
| SMILES | COc1ccc(C(=O)c2cc(C)c(OC)c(C)c2)c(OC)c1N(C(=O)C(Cl)Cl)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C22H21Cl4NO6/c1-10-8-12(9-11(2)17(10)32-4)16(28)13-6-7-14(31-3)15(18(13)33-5)27(21(29)19(23)24)22(30)20(25)26/h6-9,19-20H,1-5H3 |
| InChIKey | DASCYEOOVZMXDS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.22 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|