C10H10N6O3 — CID 155815483
ethyl 4-methyl-7-oxo-1,3,4,8,11,12-hexazatricyclo[7.3.0.02,6]dodeca-2,5,8,10-tetraene-10-carboxylate (PubChem CID 155815483) has the molecular formula C10H10N6O3 and a molecular weight of 262.23 g/mol. Its IUPAC name is ethyl 4-methyl-7-oxo-1,3,4,8,11,12-hexazatricyclo[7.3.0.02,6]dodeca-2,5,8,10-tetraene-10-carboxylate.
| Compound Name | ethyl 4-methyl-7-oxo-1,3,4,8,11,12-hexazatricyclo[7.3.0.02,6]dodeca-2,5,8,10-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 155815483 |
| Molecular Formula | C10H10N6O3 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | ethyl 4-methyl-7-oxo-1,3,4,8,11,12-hexazatricyclo[7.3.0.02,6]dodeca-2,5,8,10-tetraene-10-carboxylate |
| SMILES | CCOC(=O)c1n[nH]n2c1nc(=O)c1cn(C)nc12 |
| InChI | InChI=1S/C10H10N6O3/c1-3-19-10(18)6-8-11-9(17)5-4-15(2)13-7(5)16(8)14-12-6/h4,14H,3H2,1-2H3 |
| InChIKey | UESSIOFAZFXAPL-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |