C13H15N3O4 — CID 131864954
diethyl 7-methylpyrrolo[2,3-d]pyrimidine-2,4-dicarboxylate (PubChem CID 131864954) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is diethyl 7-methylpyrrolo[2,3-d]pyrimidine-2,4-dicarboxylate.
| Compound Name | diethyl 7-methylpyrrolo[2,3-d]pyrimidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 131864954 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | diethyl 7-methylpyrrolo[2,3-d]pyrimidine-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1nc(C(=O)OCC)c2ccn(C)c2n1 |
| InChI | InChI=1S/C13H15N3O4/c1-4-19-12(17)9-8-6-7-16(3)11(8)15-10(14-9)13(18)20-5-2/h6-7H,4-5H2,1-3H3 |
| InChIKey | ROKMRGOOPVOGDU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |