C20H18N4O4 — CID 11036225
diethyl 7-benzyl-5-cyanopyrrolo[2,3-d]pyrimidine-2,4-dicarboxylate (PubChem CID 11036225) has the molecular formula C20H18N4O4 and a molecular weight of 378.39 g/mol. Its IUPAC name is diethyl 7-benzyl-5-cyanopyrrolo[2,3-d]pyrimidine-2,4-dicarboxylate.
| Compound Name | diethyl 7-benzyl-5-cyanopyrrolo[2,3-d]pyrimidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 11036225 |
| Molecular Formula | C20H18N4O4 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | diethyl 7-benzyl-5-cyanopyrrolo[2,3-d]pyrimidine-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1nc(C(=O)OCC)c2c(C#N)cn(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C20H18N4O4/c1-3-27-19(25)16-15-14(10-21)12-24(11-13-8-6-5-7-9-13)18(15)23-17(22-16)20(26)28-4-2/h5-9,12H,3-4,11H2,1-2H3 |
| InChIKey | CVTDVCHUPYJWQM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 107.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |