C18H13N3O3 — CID 155817119
5-(6-methoxynaphthalen-2-yl)-1H-pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 155817119) has the molecular formula C18H13N3O3 and a molecular weight of 319.32 g/mol. Its IUPAC name is 5-(6-methoxynaphthalen-2-yl)-1H-pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 5-(6-methoxynaphthalen-2-yl)-1H-pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 155817119 |
| Molecular Formula | C18H13N3O3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 5-(6-methoxynaphthalen-2-yl)-1H-pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | COc1ccc2cc(-c3ccnc4[nH]c(=O)[nH]c(=O)c34)ccc2c1 |
| InChI | InChI=1S/C18H13N3O3/c1-24-13-5-4-10-8-12(3-2-11(10)9-13)14-6-7-19-16-15(14)17(22)21-18(23)20-16/h2-9H,1H3,(H2,19,20,21,22,23) |
| InChIKey | GQNNZNLSXQIECW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |