C25H19N3O2S — CID 175666045
6-methoxy-3-[(4-naphthalen-2-ylpyrimidin-2-yl)sulfanylmethyl]-1H-quinolin-2-one (PubChem CID 175666045) has the molecular formula C25H19N3O2S and a molecular weight of 425.51 g/mol. Its IUPAC name is 6-methoxy-3-[(4-naphthalen-2-ylpyrimidin-2-yl)sulfanylmethyl]-1H-quinolin-2-one.
| Compound Name | 6-methoxy-3-[(4-naphthalen-2-ylpyrimidin-2-yl)sulfanylmethyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 175666045 |
| Molecular Formula | C25H19N3O2S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 6-methoxy-3-[(4-naphthalen-2-ylpyrimidin-2-yl)sulfanylmethyl]-1H-quinolin-2-one |
| SMILES | COc1ccc2[nH]c(=O)c(CSc3nccc(-c4ccc5ccccc5c4)n3)cc2c1 |
| InChI | InChI=1S/C25H19N3O2S/c1-30-21-8-9-22-19(14-21)13-20(24(29)27-22)15-31-25-26-11-10-23(28-25)18-7-6-16-4-2-3-5-17(16)12-18/h2-14H,15H2,1H3,(H,27,29) |
| InChIKey | BYBVAMNLPSFZNS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |