C28H23N3O4 — CID 175658405
N-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-2-(4-methoxyphenyl)quinoline-4-carboxamide (PubChem CID 175658405) has the molecular formula C28H23N3O4 and a molecular weight of 465.51 g/mol. Its IUPAC name is N-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-2-(4-methoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-2-(4-methoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 175658405 |
| Molecular Formula | C28H23N3O4 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | N-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-2-(4-methoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NCc3cc4cc(OC)ccc4[nH]c3=O)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C28H23N3O4/c1-34-20-9-7-17(8-10-20)26-15-23(22-5-3-4-6-25(22)30-26)28(33)29-16-19-13-18-14-21(35-2)11-12-24(18)31-27(19)32/h3-15H,16H2,1-2H3,(H,29,33)(H,31,32) |
| InChIKey | KWCMRLKJWMLEGR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |