C16H15N3O — CID 155818568
5-methyl-3-(2-phenylmethoxyphenyl)-1H-1,2,4-triazole (PubChem CID 155818568) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is 5-methyl-3-(2-phenylmethoxyphenyl)-1H-1,2,4-triazole.
| Compound Name | 5-methyl-3-(2-phenylmethoxyphenyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 155818568 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 5-methyl-3-(2-phenylmethoxyphenyl)-1H-1,2,4-triazole |
| SMILES | Cc1nc(-c2ccccc2OCc2ccccc2)n[nH]1 |
| InChI | InChI=1S/C16H15N3O/c1-12-17-16(19-18-12)14-9-5-6-10-15(14)20-11-13-7-3-2-4-8-13/h2-10H,11H2,1H3,(H,17,18,19) |
| InChIKey | NPTNHLPXAAOUPO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |