C15H22N2O3S — CID 155820239
tert-butyl 1-imino-1-oxo-3-phenyl-1,4-thiazinane-4-carboxylate (PubChem CID 155820239) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is tert-butyl 1-imino-1-oxo-3-phenyl-1,4-thiazinane-4-carboxylate.
| Compound Name | tert-butyl 1-imino-1-oxo-3-phenyl-1,4-thiazinane-4-carboxylate |
|---|---|
| PubChem CID | 155820239 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | tert-butyl 1-imino-1-oxo-3-phenyl-1,4-thiazinane-4-carboxylate |
| SMILES | [H]N=S1(=O)CCN(C(=O)OC(C)(C)C)C(c2ccccc2)C1 |
| InChI | InChI=1S/C15H22N2O3S/c1-15(2,3)20-14(18)17-9-10-21(16,19)11-13(17)12-7-5-4-6-8-12/h4-8,13,16H,9-11H2,1-3H3 |
| InChIKey | YUWUKGZBBXWWJN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |