C9H7N3O3 — CID 155820270
methyl 3-formylpyrazolo[1,5-a]pyrazine-4-carboxylate (PubChem CID 155820270) has the molecular formula C9H7N3O3 and a molecular weight of 205.17 g/mol. Its IUPAC name is methyl 3-formylpyrazolo[1,5-a]pyrazine-4-carboxylate.
| Compound Name | methyl 3-formylpyrazolo[1,5-a]pyrazine-4-carboxylate |
|---|---|
| PubChem CID | 155820270 |
| Molecular Formula | C9H7N3O3 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | methyl 3-formylpyrazolo[1,5-a]pyrazine-4-carboxylate |
| SMILES | COC(=O)c1nccn2ncc(C=O)c12 |
| InChI | InChI=1S/C9H7N3O3/c1-15-9(14)7-8-6(5-13)4-11-12(8)3-2-10-7/h2-5H,1H3 |
| InChIKey | YSZCUPNEYQCPOC-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|