C13H12F2N4O3 — CID 171501623
ethyl 1-(difluoromethyl)-4-(pyridine-3-carbonylamino)pyrazole-5-carboxylate (PubChem CID 171501623) has the molecular formula C13H12F2N4O3 and a molecular weight of 310.26 g/mol. Its IUPAC name is ethyl 1-(difluoromethyl)-4-(pyridine-3-carbonylamino)pyrazole-5-carboxylate.
| Compound Name | ethyl 1-(difluoromethyl)-4-(pyridine-3-carbonylamino)pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 171501623 |
| Molecular Formula | C13H12F2N4O3 |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | ethyl 1-(difluoromethyl)-4-(pyridine-3-carbonylamino)pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2cccnc2)cnn1C(F)F |
| InChI | InChI=1S/C13H12F2N4O3/c1-2-22-12(21)10-9(7-17-19(10)13(14)15)18-11(20)8-4-3-5-16-6-8/h3-7,13H,2H2,1H3,(H,18,20) |
| InChIKey | JXWMGQRVLQCQRT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |