About [(1S,2S)-2-fluorocyclopropyl]methanamine;hydrochloride
[(1S,2S)-2-fluorocyclopropyl]methanamine;hydrochloride (PubChem CID 155820456) has the molecular formula C4H9ClFN
and a molecular weight of 125.57 g/mol. Its IUPAC name is [(1S,2S)-2-fluorocyclopropyl]methanamine;hydrochloride.
Analyze [(1S,2S)-2-fluorocyclopropyl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-fluorocyclopropyl]methanamine;hydrochloride?
The IUPAC name of [(1S,2S)-2-fluorocyclopropyl]methanamine;hydrochloride (CID 155820456) is [(1S,2S)-2-fluorocyclopropyl]methanamine;hydrochloride.
What is the SMILES notation for [(1S,2S)-2-fluorocyclopropyl]methanamine;hydrochloride?
The canonical SMILES for [(1S,2S)-2-fluorocyclopropyl]methanamine;hydrochloride is Cl.NC[C@@H]1C[C@@H]1F.
What is the InChIKey of [(1S,2S)-2-fluorocyclopropyl]methanamine;hydrochloride?
The InChIKey is OCMRWDMRPODKRO-MMALYQPHSA-N. The full InChI is InChI=1S/C4H8FN.ClH/c5-4-1-3(4)2-6;/h3-4H,1-2,6H2;1H/t3-,4-;/m0./s1.
What are the key properties of [(1S,2S)-2-fluorocyclopropyl]methanamine;hydrochloride?
[(1S,2S)-2-fluorocyclopropyl]methanamine;hydrochloride has a molecular weight of 125.57 g/mol, XLogP of 0.72, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-fluorocyclopropyl]methanamine;hydrochloride is sourced from PubChem (CID 155820456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).