C21H32F6N4O5 — CID 155824088
(4aS,8R,8aS)-N,N-diethyl-6-[(1-methylpyrazol-4-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155824088) has the molecular formula C21H32F6N4O5 and a molecular weight of 534.50 g/mol. Its IUPAC name is (4aS,8R,8aS)-N,N-diethyl-6-[(1-methylpyrazol-4-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (4aS,8R,8aS)-N,N-diethyl-6-[(1-methylpyrazol-4-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155824088 |
| Molecular Formula | C21H32F6N4O5 |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | (4aS,8R,8aS)-N,N-diethyl-6-[(1-methylpyrazol-4-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCN(CC)[C@@H]1CN(Cc2cnn(C)c2)C[C@@H]2CCCO[C@@H]21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H30N4O.2C2HF3O2/c1-4-21(5-2)16-13-20(11-14-9-18-19(3)10-14)12-15-7-6-8-22-17(15)16;2*3-2(4,5)1(6)7/h9-10,15-17H,4-8,11-13H2,1-3H3;2*(H,6,7)/t15-,16+,17-;;/m0../s1 |
| InChIKey | AYAYXGLQTCJQOS-ZKSXZVJESA-N |
| XLogP | 3.01 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |