C20H19F3N4O4S — CID 155824495
[6-(pyridin-2-yloxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]-thiophen-2-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155824495) has the molecular formula C20H19F3N4O4S and a molecular weight of 468.46 g/mol. Its IUPAC name is [6-(pyridin-2-yloxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]-thiophen-2-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [6-(pyridin-2-yloxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]-thiophen-2-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155824495 |
| Molecular Formula | C20H19F3N4O4S |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | [6-(pyridin-2-yloxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]-thiophen-2-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1cccs1)N1Cc2cncn2CC(COc2ccccn2)C1 |
| InChI | InChI=1S/C18H18N4O2S.C2HF3O2/c23-18(16-4-3-7-25-16)21-9-14(10-22-13-19-8-15(22)11-21)12-24-17-5-1-2-6-20-17;3-2(4,5)1(6)7/h1-8,13-14H,9-12H2;(H,6,7) |
| InChIKey | PJFIAUVBHDYVPF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |