C21H22F6N4O5S — CID 155824836
[(3aR,7aS)-2-(pyridin-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-(1,3-thiazol-4-yl)methanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155824836) has the molecular formula C21H22F6N4O5S and a molecular weight of 556.49 g/mol. Its IUPAC name is [(3aR,7aS)-2-(pyridin-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-(1,3-thiazol-4-yl)methanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [(3aR,7aS)-2-(pyridin-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-(1,3-thiazol-4-yl)methanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155824836 |
| Molecular Formula | C21H22F6N4O5S |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 556.12 |
| IUPAC Name | [(3aR,7aS)-2-(pyridin-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-(1,3-thiazol-4-yl)methanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C(c1cscn1)N1CC[C@@H]2CN(Cc3cccnc3)C[C@@H]2C1 |
| InChI | InChI=1S/C17H20N4OS.2C2HF3O2/c22-17(16-11-23-12-19-16)21-5-3-14-8-20(9-15(14)10-21)7-13-2-1-4-18-6-13;2*3-2(4,5)1(6)7/h1-2,4,6,11-12,14-15H,3,5,7-10H2;2*(H,6,7)/t14-,15-;;/m1../s1 |
| InChIKey | USZXTGAPLPKVAT-FXUMYAARSA-N |
| XLogP | 3.40 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |