C22H25F6N3O4S — CID 171690003
5-[(5-methylthiophen-2-yl)methyl]-2-(pyridin-3-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171690003) has the molecular formula C22H25F6N3O4S and a molecular weight of 541.51 g/mol. Its IUPAC name is 5-[(5-methylthiophen-2-yl)methyl]-2-(pyridin-3-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 5-[(5-methylthiophen-2-yl)methyl]-2-(pyridin-3-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171690003 |
| Molecular Formula | C22H25F6N3O4S |
| Molecular Weight | 541.51 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | 5-[(5-methylthiophen-2-yl)methyl]-2-(pyridin-3-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ccc(CN2CC3CN(Cc4cccnc4)CC3C2)s1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H23N3S.2C2HF3O2/c1-14-4-5-18(22-14)13-21-11-16-9-20(10-17(16)12-21)8-15-3-2-6-19-7-15;2*3-2(4,5)1(6)7/h2-7,16-17H,8-13H2,1H3;2*(H,6,7) |
| InChIKey | ZGZSYHOVSHXTPD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |