C23H25F6N3O5S — CID 118751137
2-[(5-methylthiophen-2-yl)methyl]-5-(pyridin-3-ylmethyl)-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118751137) has the molecular formula C23H25F6N3O5S and a molecular weight of 569.52 g/mol. Its IUPAC name is 2-[(5-methylthiophen-2-yl)methyl]-5-(pyridin-3-ylmethyl)-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[(5-methylthiophen-2-yl)methyl]-5-(pyridin-3-ylmethyl)-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118751137 |
| Molecular Formula | C23H25F6N3O5S |
| Molecular Weight | 569.52 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | 2-[(5-methylthiophen-2-yl)methyl]-5-(pyridin-3-ylmethyl)-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ccc(CN2CC3CCN(Cc4cccnc4)C(=O)C3C2)s1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H23N3OS.2C2HF3O2/c1-14-4-5-17(24-14)12-21-11-16-6-8-22(19(23)18(16)13-21)10-15-3-2-7-20-9-15;2*3-2(4,5)1(6)7/h2-5,7,9,16,18H,6,8,10-13H2,1H3;2*(H,6,7) |
| InChIKey | MROAZKIBAJCHGC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 111.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |