C25H24F6N4O5S — CID 155826966
(2S,6R)-4-[(5-methylthiophen-2-yl)methyl]-7-(pyridin-3-ylmethyl)-1,4,7-triazatricyclo[7.3.0.02,6]dodeca-9,11-dien-8-one;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155826966) has the molecular formula C25H24F6N4O5S and a molecular weight of 606.55 g/mol. Its IUPAC name is (2S,6R)-4-[(5-methylthiophen-2-yl)methyl]-7-(pyridin-3-ylmethyl)-1,4,7-triazatricyclo[7.3.0.02,6]dodeca-9,11-dien-8-one;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (2S,6R)-4-[(5-methylthiophen-2-yl)methyl]-7-(pyridin-3-ylmethyl)-1,4,7-triazatricyclo[7.3.0.02,6]dodeca-9,11-dien-8-one;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155826966 |
| Molecular Formula | C25H24F6N4O5S |
| Molecular Weight | 606.55 g/mol |
| Exact Mass | 606.14 |
| IUPAC Name | (2S,6R)-4-[(5-methylthiophen-2-yl)methyl]-7-(pyridin-3-ylmethyl)-1,4,7-triazatricyclo[7.3.0.02,6]dodeca-9,11-dien-8-one;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ccc(CN2C[C@@H]3[C@H](C2)n2cccc2C(=O)N3Cc2cccnc2)s1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H22N4OS.2C2HF3O2/c1-15-6-7-17(27-15)12-23-13-19-20(14-23)25(11-16-4-2-8-22-10-16)21(26)18-5-3-9-24(18)19;2*3-2(4,5)1(6)7/h2-10,19-20H,11-14H2,1H3;2*(H,6,7)/t19-,20+;;/m0../s1 |
| InChIKey | JHZKQMQQWNKMCV-HUQPAIQZSA-N |
| XLogP | 4.60 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |