C25H26F3N3O4S — CID 155864282
7-[(4-methoxyphenyl)methyl]-4-[(5-methylthiophen-2-yl)methyl]-1,4,7-triazatricyclo[7.3.0.02,6]dodeca-9,11-dien-8-one;2,2,2-trifluoroacetic acid (PubChem CID 155864282) has the molecular formula C25H26F3N3O4S and a molecular weight of 521.56 g/mol. Its IUPAC name is 7-[(4-methoxyphenyl)methyl]-4-[(5-methylthiophen-2-yl)methyl]-1,4,7-triazatricyclo[7.3.0.02,6]dodeca-9,11-dien-8-one;2,2,2-trifluoroacetic acid.
| Compound Name | 7-[(4-methoxyphenyl)methyl]-4-[(5-methylthiophen-2-yl)methyl]-1,4,7-triazatricyclo[7.3.0.02,6]dodeca-9,11-dien-8-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155864282 |
| Molecular Formula | C25H26F3N3O4S |
| Molecular Weight | 521.56 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | 7-[(4-methoxyphenyl)methyl]-4-[(5-methylthiophen-2-yl)methyl]-1,4,7-triazatricyclo[7.3.0.02,6]dodeca-9,11-dien-8-one;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(CN2C(=O)c3cccn3C3CN(Cc4ccc(C)s4)CC32)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H25N3O2S.C2HF3O2/c1-16-5-10-19(29-16)13-24-14-21-22(15-24)26(23(27)20-4-3-11-25(20)21)12-17-6-8-18(28-2)9-7-17;3-2(4,5)1(6)7/h3-11,21-22H,12-15H2,1-2H3;(H,6,7) |
| InChIKey | DRTRXVKEMANKSP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |