C24H23F6N5O5S — CID 155831402
7-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-(pyridin-3-ylmethyl)-1,4,7-triazatricyclo[7.3.0.02,6]dodeca-9,11-dien-8-one;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155831402) has the molecular formula C24H23F6N5O5S and a molecular weight of 607.53 g/mol. Its IUPAC name is 7-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-(pyridin-3-ylmethyl)-1,4,7-triazatricyclo[7.3.0.02,6]dodeca-9,11-dien-8-one;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 7-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-(pyridin-3-ylmethyl)-1,4,7-triazatricyclo[7.3.0.02,6]dodeca-9,11-dien-8-one;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155831402 |
| Molecular Formula | C24H23F6N5O5S |
| Molecular Weight | 607.53 g/mol |
| Exact Mass | 607.13 |
| IUPAC Name | 7-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-(pyridin-3-ylmethyl)-1,4,7-triazatricyclo[7.3.0.02,6]dodeca-9,11-dien-8-one;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1nc(CN2C(=O)c3cccn3C3CN(Cc4cccnc4)CC32)cs1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H21N5OS.2C2HF3O2/c1-14-22-16(13-27-14)10-25-19-12-23(9-15-4-2-6-21-8-15)11-18(19)24-7-3-5-17(24)20(25)26;2*3-2(4,5)1(6)7/h2-8,13,18-19H,9-12H2,1H3;2*(H,6,7) |
| InChIKey | NNEIGCBBEZGMKM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 128.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |