C23H22ClF3N4O3S — CID 155863104
4-[(4-chlorophenyl)methyl]-7-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4,7-triazatricyclo[7.3.0.02,6]dodeca-9,11-dien-8-one;2,2,2-trifluoroacetic acid (PubChem CID 155863104) has the molecular formula C23H22ClF3N4O3S and a molecular weight of 526.97 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-7-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4,7-triazatricyclo[7.3.0.02,6]dodeca-9,11-dien-8-one;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[(4-chlorophenyl)methyl]-7-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4,7-triazatricyclo[7.3.0.02,6]dodeca-9,11-dien-8-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155863104 |
| Molecular Formula | C23H22ClF3N4O3S |
| Molecular Weight | 526.97 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-7-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4,7-triazatricyclo[7.3.0.02,6]dodeca-9,11-dien-8-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2C(=O)c3cccn3C3CN(Cc4ccc(Cl)cc4)CC32)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H21ClN4OS.C2HF3O2/c1-14-23-17(13-28-14)10-26-20-12-24(9-15-4-6-16(22)7-5-15)11-19(20)25-8-2-3-18(25)21(26)27;3-2(4,5)1(6)7/h2-8,13,19-20H,9-12H2,1H3;(H,6,7) |
| InChIKey | AFGPYRDZIXKRTG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.97 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |