C18H24F3N5O5 — CID 155826204
5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-(2-methoxyethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-7-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155826204) has the molecular formula C18H24F3N5O5 and a molecular weight of 447.41 g/mol. Its IUPAC name is 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-(2-methoxyethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-7-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-(2-methoxyethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-7-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826204 |
| Molecular Formula | C18H24F3N5O5 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-(2-methoxyethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-7-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCNC(=O)C1CN(Cc2c(C)noc2C)Cc2ccnn21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H23N5O3.C2HF3O2/c1-11-14(12(2)24-19-11)9-20-8-13-4-5-18-21(13)15(10-20)16(22)17-6-7-23-3;3-2(4,5)1(6)7/h4-5,15H,6-10H2,1-3H3,(H,17,22);(H,6,7) |
| InChIKey | GXYPOCHOTFIQQD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|