C20H23F6N3O6 — CID 171685867
4-[[5-(methoxymethyl)-3,4-dihydro-1H-2,7-naphthyridin-2-yl]methyl]-3,5-dimethyl-1,2-oxazole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171685867) has the molecular formula C20H23F6N3O6 and a molecular weight of 515.41 g/mol. Its IUPAC name is 4-[[5-(methoxymethyl)-3,4-dihydro-1H-2,7-naphthyridin-2-yl]methyl]-3,5-dimethyl-1,2-oxazole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[[5-(methoxymethyl)-3,4-dihydro-1H-2,7-naphthyridin-2-yl]methyl]-3,5-dimethyl-1,2-oxazole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171685867 |
| Molecular Formula | C20H23F6N3O6 |
| Molecular Weight | 515.41 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | 4-[[5-(methoxymethyl)-3,4-dihydro-1H-2,7-naphthyridin-2-yl]methyl]-3,5-dimethyl-1,2-oxazole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COCc1cncc2c1CCN(Cc1c(C)noc1C)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H21N3O2.2C2HF3O2/c1-11-16(12(2)21-18-11)9-19-5-4-15-13(8-19)6-17-7-14(15)10-20-3;2*3-2(4,5)1(6)7/h6-7H,4-5,8-10H2,1-3H3;2*(H,6,7) |
| InChIKey | LXMYAVDJZMOPAU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |