C22H24F6N2O5S — CID 155855905
2-[(5-methylthiophen-2-yl)methyl]-5-(prop-2-enoxymethyl)-3,4-dihydro-1H-2,7-naphthyridine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155855905) has the molecular formula C22H24F6N2O5S and a molecular weight of 542.50 g/mol. Its IUPAC name is 2-[(5-methylthiophen-2-yl)methyl]-5-(prop-2-enoxymethyl)-3,4-dihydro-1H-2,7-naphthyridine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[(5-methylthiophen-2-yl)methyl]-5-(prop-2-enoxymethyl)-3,4-dihydro-1H-2,7-naphthyridine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155855905 |
| Molecular Formula | C22H24F6N2O5S |
| Molecular Weight | 542.50 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | 2-[(5-methylthiophen-2-yl)methyl]-5-(prop-2-enoxymethyl)-3,4-dihydro-1H-2,7-naphthyridine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | C=CCOCc1cncc2c1CCN(Cc1ccc(C)s1)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H22N2OS.2C2HF3O2/c1-3-8-21-13-16-10-19-9-15-11-20(7-6-18(15)16)12-17-5-4-14(2)22-17;2*3-2(4,5)1(6)7/h3-5,9-10H,1,6-8,11-13H2,2H3;2*(H,6,7) |
| InChIKey | JHWXSBITGAHTLF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|