C21H22F6N2O5S — CID 155828636
5-(prop-2-enoxymethyl)-2-(thiophen-2-ylmethyl)-3,4-dihydro-1H-2,7-naphthyridine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155828636) has the molecular formula C21H22F6N2O5S and a molecular weight of 528.47 g/mol. Its IUPAC name is 5-(prop-2-enoxymethyl)-2-(thiophen-2-ylmethyl)-3,4-dihydro-1H-2,7-naphthyridine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 5-(prop-2-enoxymethyl)-2-(thiophen-2-ylmethyl)-3,4-dihydro-1H-2,7-naphthyridine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155828636 |
| Molecular Formula | C21H22F6N2O5S |
| Molecular Weight | 528.47 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | 5-(prop-2-enoxymethyl)-2-(thiophen-2-ylmethyl)-3,4-dihydro-1H-2,7-naphthyridine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | C=CCOCc1cncc2c1CCN(Cc1cccs1)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H20N2OS.2C2HF3O2/c1-2-7-20-13-15-10-18-9-14-11-19(6-5-17(14)15)12-16-4-3-8-21-16;2*3-2(4,5)1(6)7/h2-4,8-10H,1,5-7,11-13H2;2*(H,6,7) |
| InChIKey | IRAHCDHNSULKAN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|