C18H22F3N3O3S — CID 155857263
1-methyl-3-(prop-2-enoxymethyl)-5-(thiophen-2-ylmethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 155857263) has the molecular formula C18H22F3N3O3S and a molecular weight of 417.45 g/mol. Its IUPAC name is 1-methyl-3-(prop-2-enoxymethyl)-5-(thiophen-2-ylmethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | 1-methyl-3-(prop-2-enoxymethyl)-5-(thiophen-2-ylmethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155857263 |
| Molecular Formula | C18H22F3N3O3S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 1-methyl-3-(prop-2-enoxymethyl)-5-(thiophen-2-ylmethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | C=CCOCc1nn(C)c2c1CN(Cc1cccs1)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H21N3OS.C2HF3O2/c1-3-8-20-12-15-14-11-19(10-13-5-4-9-21-13)7-6-16(14)18(2)17-15;3-2(4,5)1(6)7/h3-5,9H,1,6-8,10-12H2,2H3;(H,6,7) |
| InChIKey | STRAMNRYLDVIDG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|