C19H26F3NO4S — CID 155841768
(4S,5S)-4-(prop-2-enoxymethyl)-9-(thiophen-2-ylmethyl)-6-oxa-9-azaspiro[4.5]decane;2,2,2-trifluoroacetic acid (PubChem CID 155841768) has the molecular formula C19H26F3NO4S and a molecular weight of 421.48 g/mol. Its IUPAC name is (4S,5S)-4-(prop-2-enoxymethyl)-9-(thiophen-2-ylmethyl)-6-oxa-9-azaspiro[4.5]decane;2,2,2-trifluoroacetic acid.
| Compound Name | (4S,5S)-4-(prop-2-enoxymethyl)-9-(thiophen-2-ylmethyl)-6-oxa-9-azaspiro[4.5]decane;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155841768 |
| Molecular Formula | C19H26F3NO4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | (4S,5S)-4-(prop-2-enoxymethyl)-9-(thiophen-2-ylmethyl)-6-oxa-9-azaspiro[4.5]decane;2,2,2-trifluoroacetic acid |
| SMILES | C=CCOC[C@@H]1CCC[C@@]12CN(Cc1cccs1)CCO2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25NO2S.C2HF3O2/c1-2-9-19-13-15-5-3-7-17(15)14-18(8-10-20-17)12-16-6-4-11-21-16;3-2(4,5)1(6)7/h2,4,6,11,15H,1,3,5,7-10,12-14H2;(H,6,7)/t15-,17+;/m0./s1 |
| InChIKey | SGWXVYLJBJACPQ-KPVRICSOSA-N |
| XLogP | 3.96 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|