C18H27NO3 — CID 97375141
(4S,5S)-9-[(5-methylfuran-2-yl)methyl]-4-(prop-2-enoxymethyl)-6-oxa-9-azaspiro[4.5]decane (PubChem CID 97375141) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is (4S,5S)-9-[(5-methylfuran-2-yl)methyl]-4-(prop-2-enoxymethyl)-6-oxa-9-azaspiro[4.5]decane.
| Compound Name | (4S,5S)-9-[(5-methylfuran-2-yl)methyl]-4-(prop-2-enoxymethyl)-6-oxa-9-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 97375141 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | (4S,5S)-9-[(5-methylfuran-2-yl)methyl]-4-(prop-2-enoxymethyl)-6-oxa-9-azaspiro[4.5]decane |
| SMILES | C=CCOC[C@@H]1CCC[C@@]12CN(Cc1ccc(C)o1)CCO2 |
| InChI | InChI=1S/C18H27NO3/c1-3-10-20-13-16-5-4-8-18(16)14-19(9-11-21-18)12-17-7-6-15(2)22-17/h3,6-7,16H,1,4-5,8-14H2,2H3/t16-,18+/m0/s1 |
| InChIKey | XIDSNEVAINNFGE-FUHWJXTLSA-N |
| XLogP | 3.16 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|