C17H25NO3 — CID 97371565
(3S,5R)-9-[(5-methylfuran-2-yl)methyl]-3-prop-2-enoxy-1-oxa-9-azaspiro[4.5]decane (PubChem CID 97371565) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (3S,5R)-9-[(5-methylfuran-2-yl)methyl]-3-prop-2-enoxy-1-oxa-9-azaspiro[4.5]decane.
| Compound Name | (3S,5R)-9-[(5-methylfuran-2-yl)methyl]-3-prop-2-enoxy-1-oxa-9-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 97371565 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (3S,5R)-9-[(5-methylfuran-2-yl)methyl]-3-prop-2-enoxy-1-oxa-9-azaspiro[4.5]decane |
| SMILES | C=CCO[C@@H]1CO[C@]2(CCCN(Cc3ccc(C)o3)C2)C1 |
| InChI | InChI=1S/C17H25NO3/c1-3-9-19-16-10-17(20-12-16)7-4-8-18(13-17)11-15-6-5-14(2)21-15/h3,5-6,16H,1,4,7-13H2,2H3/t16-,17+/m0/s1 |
| InChIKey | SZLCPPFJDJPDNL-DLBZAZTESA-N |
| XLogP | 2.91 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|