C16H23NO2S — CID 97371548
(3R,5S)-3-prop-2-enoxy-9-(thiophen-2-ylmethyl)-1-oxa-9-azaspiro[4.5]decane (PubChem CID 97371548) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is (3R,5S)-3-prop-2-enoxy-9-(thiophen-2-ylmethyl)-1-oxa-9-azaspiro[4.5]decane.
| Compound Name | (3R,5S)-3-prop-2-enoxy-9-(thiophen-2-ylmethyl)-1-oxa-9-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 97371548 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (3R,5S)-3-prop-2-enoxy-9-(thiophen-2-ylmethyl)-1-oxa-9-azaspiro[4.5]decane |
| SMILES | C=CCO[C@H]1CO[C@@]2(CCCN(Cc3cccs3)C2)C1 |
| InChI | InChI=1S/C16H23NO2S/c1-2-8-18-14-10-16(19-12-14)6-4-7-17(13-16)11-15-5-3-9-20-15/h2-3,5,9,14H,1,4,6-8,10-13H2/t14-,16+/m1/s1 |
| InChIKey | ZPDXWRGBFHNNDK-ZBFHGGJFSA-N |
| XLogP | 3.07 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|