C17H22N2O3 — CID 97489662
[(3S,5S)-3-prop-2-enoxy-1-oxa-9-azaspiro[4.5]decan-9-yl]-pyridin-3-ylmethanone (PubChem CID 97489662) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is [(3S,5S)-3-prop-2-enoxy-1-oxa-9-azaspiro[4.5]decan-9-yl]-pyridin-3-ylmethanone.
| Compound Name | [(3S,5S)-3-prop-2-enoxy-1-oxa-9-azaspiro[4.5]decan-9-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 97489662 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | [(3S,5S)-3-prop-2-enoxy-1-oxa-9-azaspiro[4.5]decan-9-yl]-pyridin-3-ylmethanone |
| SMILES | C=CCO[C@@H]1CO[C@@]2(CCCN(C(=O)c3cccnc3)C2)C1 |
| InChI | InChI=1S/C17H22N2O3/c1-2-9-21-15-10-17(22-12-15)6-4-8-19(13-17)16(20)14-5-3-7-18-11-14/h2-3,5,7,11,15H,1,4,6,8-10,12-13H2/t15-,17-/m0/s1 |
| InChIKey | XJCUXOIQRZNWOS-RDJZCZTQSA-N |
| XLogP | 2.05 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|