C20H23N3O3 — CID 97418982
pyridin-3-yl-[(3S)-3-(pyridin-3-ylmethoxy)-1-oxa-8-azaspiro[4.5]decan-8-yl]methanone (PubChem CID 97418982) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is pyridin-3-yl-[(3S)-3-(pyridin-3-ylmethoxy)-1-oxa-8-azaspiro[4.5]decan-8-yl]methanone.
| Compound Name | pyridin-3-yl-[(3S)-3-(pyridin-3-ylmethoxy)-1-oxa-8-azaspiro[4.5]decan-8-yl]methanone |
|---|---|
| PubChem CID | 97418982 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | pyridin-3-yl-[(3S)-3-(pyridin-3-ylmethoxy)-1-oxa-8-azaspiro[4.5]decan-8-yl]methanone |
| SMILES | O=C(c1cccnc1)N1CCC2(CC1)C[C@H](OCc1cccnc1)CO2 |
| InChI | InChI=1S/C20H23N3O3/c24-19(17-4-2-8-22-13-17)23-9-5-20(6-10-23)11-18(15-26-20)25-14-16-3-1-7-21-12-16/h1-4,7-8,12-13,18H,5-6,9-11,14-15H2/t18-/m0/s1 |
| InChIKey | KYYGOOMTUNIAFV-SFHVURJKSA-N |
| XLogP | 2.46 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |