C14H25NO4S — CID 97375150
(4S,5S)-9-ethylsulfonyl-4-(prop-2-enoxymethyl)-6-oxa-9-azaspiro[4.5]decane (PubChem CID 97375150) has the molecular formula C14H25NO4S and a molecular weight of 303.42 g/mol. Its IUPAC name is (4S,5S)-9-ethylsulfonyl-4-(prop-2-enoxymethyl)-6-oxa-9-azaspiro[4.5]decane.
| Compound Name | (4S,5S)-9-ethylsulfonyl-4-(prop-2-enoxymethyl)-6-oxa-9-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 97375150 |
| Molecular Formula | C14H25NO4S |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (4S,5S)-9-ethylsulfonyl-4-(prop-2-enoxymethyl)-6-oxa-9-azaspiro[4.5]decane |
| SMILES | C=CCOC[C@@H]1CCC[C@@]12CN(S(=O)(=O)CC)CCO2 |
| InChI | InChI=1S/C14H25NO4S/c1-3-9-18-11-13-6-5-7-14(13)12-15(8-10-19-14)20(16,17)4-2/h3,13H,1,4-12H2,2H3/t13-,14+/m0/s1 |
| InChIKey | ADYKODAVFVPWOQ-UONOGXRCSA-N |
| XLogP | 1.41 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|