C16H18F3N3O3S — CID 118743407
4-methoxy-7-(thiophen-2-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid (PubChem CID 118743407) has the molecular formula C16H18F3N3O3S and a molecular weight of 389.40 g/mol. Its IUPAC name is 4-methoxy-7-(thiophen-2-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-methoxy-7-(thiophen-2-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118743407 |
| Molecular Formula | C16H18F3N3O3S |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 4-methoxy-7-(thiophen-2-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid |
| SMILES | COc1ncnc2c1CCN(Cc1cccs1)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H17N3OS.C2HF3O2/c1-18-14-12-4-6-17(9-11-3-2-8-19-11)7-5-13(12)15-10-16-14;3-2(4,5)1(6)7/h2-3,8,10H,4-7,9H2,1H3;(H,6,7) |
| InChIKey | KAFACRQFBMEMPE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |