C22H21F4N3O2S — CID 155829708
4-(4-fluorophenyl)-7-[(5-methylthiophen-2-yl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid (PubChem CID 155829708) has the molecular formula C22H21F4N3O2S and a molecular weight of 467.49 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-7-[(5-methylthiophen-2-yl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(4-fluorophenyl)-7-[(5-methylthiophen-2-yl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155829708 |
| Molecular Formula | C22H21F4N3O2S |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 4-(4-fluorophenyl)-7-[(5-methylthiophen-2-yl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(CN2CCc3ncnc(-c4ccc(F)cc4)c3CC2)s1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H20FN3S.C2HF3O2/c1-14-2-7-17(25-14)12-24-10-8-18-19(9-11-24)22-13-23-20(18)15-3-5-16(21)6-4-15;3-2(4,5)1(6)7/h2-7,13H,8-12H2,1H3;(H,6,7) |
| InChIKey | FTLQYIDIVQNHJF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |