C19H20F3N5O2S — CID 155855248
4-(1-methylpyrazol-4-yl)-7-(thiophen-2-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid (PubChem CID 155855248) has the molecular formula C19H20F3N5O2S and a molecular weight of 439.46 g/mol. Its IUPAC name is 4-(1-methylpyrazol-4-yl)-7-(thiophen-2-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(1-methylpyrazol-4-yl)-7-(thiophen-2-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155855248 |
| Molecular Formula | C19H20F3N5O2S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 4-(1-methylpyrazol-4-yl)-7-(thiophen-2-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid |
| SMILES | Cn1cc(-c2ncnc3c2CCN(Cc2cccs2)CC3)cn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H19N5S.C2HF3O2/c1-21-10-13(9-20-21)17-15-4-6-22(11-14-3-2-8-23-14)7-5-16(15)18-12-19-17;3-2(4,5)1(6)7/h2-3,8-10,12H,4-7,11H2,1H3;(H,6,7) |
| InChIKey | QRMBTLIMNPJKRM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |