C21H26F6N6O4 — CID 171696661
N-cyclobutyl-7-[(1-methylpyrazol-4-yl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171696661) has the molecular formula C21H26F6N6O4 and a molecular weight of 540.47 g/mol. Its IUPAC name is N-cyclobutyl-7-[(1-methylpyrazol-4-yl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-cyclobutyl-7-[(1-methylpyrazol-4-yl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171696661 |
| Molecular Formula | C21H26F6N6O4 |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | N-cyclobutyl-7-[(1-methylpyrazol-4-yl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cn1cc(CN2CCc3ncnc(NC4CCC4)c3CC2)cn1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N6.2C2HF3O2/c1-22-10-13(9-20-22)11-23-7-5-15-16(6-8-23)18-12-19-17(15)21-14-3-2-4-14;2*3-2(4,5)1(6)7/h9-10,12,14H,2-8,11H2,1H3,(H,18,19,21);2*(H,6,7) |
| InChIKey | HLFHEMGLUSTVAX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |