C17H25F3N4O2 — CID 155855098
7-(cyclopropylmethyl)-N-propan-2-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;2,2,2-trifluoroacetic acid (PubChem CID 155855098) has the molecular formula C17H25F3N4O2 and a molecular weight of 374.41 g/mol. Its IUPAC name is 7-(cyclopropylmethyl)-N-propan-2-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 7-(cyclopropylmethyl)-N-propan-2-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155855098 |
| Molecular Formula | C17H25F3N4O2 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 7-(cyclopropylmethyl)-N-propan-2-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)Nc1ncnc2c1CCN(CC1CC1)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H24N4.C2HF3O2/c1-11(2)18-15-13-5-7-19(9-12-3-4-12)8-6-14(13)16-10-17-15;3-2(4,5)1(6)7/h10-12H,3-9H2,1-2H3,(H,16,17,18);(H,6,7) |
| InChIKey | FYTBCNXBCSWCSE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |