C23H27F6N5O4 — CID 118746206
N-cyclobutyl-7-[(6-methyl-2-pyridinyl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118746206) has the molecular formula C23H27F6N5O4 and a molecular weight of 551.49 g/mol. Its IUPAC name is N-cyclobutyl-7-[(6-methyl-2-pyridinyl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-cyclobutyl-7-[(6-methyl-2-pyridinyl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118746206 |
| Molecular Formula | C23H27F6N5O4 |
| Molecular Weight | 551.49 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | N-cyclobutyl-7-[(6-methyl-2-pyridinyl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1cccc(CN2CCc3ncnc(NC4CCC4)c3CC2)n1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H25N5.2C2HF3O2/c1-14-4-2-7-16(22-14)12-24-10-8-17-18(9-11-24)20-13-21-19(17)23-15-5-3-6-15;2*3-2(4,5)1(6)7/h2,4,7,13,15H,3,5-6,8-12H2,1H3,(H,20,21,23);2*(H,6,7) |
| InChIKey | KOKWJKOFYDRJBR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |