C18H19F4N3O2 — CID 155835537
7-ethyl-4-(4-fluorophenyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid (PubChem CID 155835537) has the molecular formula C18H19F4N3O2 and a molecular weight of 385.36 g/mol. Its IUPAC name is 7-ethyl-4-(4-fluorophenyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid.
| Compound Name | 7-ethyl-4-(4-fluorophenyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155835537 |
| Molecular Formula | C18H19F4N3O2 |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 7-ethyl-4-(4-fluorophenyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid |
| SMILES | CCN1CCc2ncnc(-c3ccc(F)cc3)c2CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H18FN3.C2HF3O2/c1-2-20-9-7-14-15(8-10-20)18-11-19-16(14)12-3-5-13(17)6-4-12;3-2(4,5)1(6)7/h3-6,11H,2,7-10H2,1H3;(H,6,7) |
| InChIKey | ZKQBFZQPICROEO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |