About 7-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-4-carboxylic acid
7-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-4-carboxylic acid (PubChem CID 83916551) has the molecular formula C10H13N3O2
and a molecular weight of 207.23 g/mol. Its IUPAC name is 7-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 7-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-4-carboxylic acid |
| PubChem CID | 83916551 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 7-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-4-carboxylic acid |
| SMILES | CCN1CCc2c(ncnc2C(=O)O)C1 |
| InChI | InChI=1S/C10H13N3O2/c1-2-13-4-3-7-8(5-13)11-6-12-9(7)10(14)15/h6H,2-5H2,1H3,(H,14,15) |
| InChIKey | DQNMILNLMDQORO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-4-carboxylic acid?
The IUPAC name of 7-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-4-carboxylic acid (CID 83916551) is 7-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-4-carboxylic acid.
What is the SMILES notation for 7-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-4-carboxylic acid?
The canonical SMILES for 7-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-4-carboxylic acid is CCN1CCc2c(ncnc2C(=O)O)C1.
What is the InChIKey of 7-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-4-carboxylic acid?
The InChIKey is DQNMILNLMDQORO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O2/c1-2-13-4-3-7-8(5-13)11-6-12-9(7)10(14)15/h6H,2-5H2,1H3,(H,14,15).
What are the key properties of 7-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-4-carboxylic acid?
7-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-4-carboxylic acid has a molecular weight of 207.23 g/mol, XLogP of 0.55, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-4-carboxylic acid is sourced from PubChem (CID 83916551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).