C24H23F6N5O5 — CID 171694900
7-[(2-methoxy-3-pyridinyl)methyl]-4-pyridin-4-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171694900) has the molecular formula C24H23F6N5O5 and a molecular weight of 575.47 g/mol. Its IUPAC name is 7-[(2-methoxy-3-pyridinyl)methyl]-4-pyridin-4-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 7-[(2-methoxy-3-pyridinyl)methyl]-4-pyridin-4-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171694900 |
| Molecular Formula | C24H23F6N5O5 |
| Molecular Weight | 575.47 g/mol |
| Exact Mass | 575.16 |
| IUPAC Name | 7-[(2-methoxy-3-pyridinyl)methyl]-4-pyridin-4-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COc1ncccc1CN1CCc2ncnc(-c3ccncc3)c2CC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H21N5O.2C2HF3O2/c1-26-20-16(3-2-8-22-20)13-25-11-6-17-18(7-12-25)23-14-24-19(17)15-4-9-21-10-5-15;2*3-2(4,5)1(6)7/h2-5,8-10,14H,6-7,11-13H2,1H3;2*(H,6,7) |
| InChIKey | GHDLIIAIGUABBI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 138.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |