C16H20F3N5O3 — CID 155855520
4-methoxy-7-[(1-methylimidazol-2-yl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid (PubChem CID 155855520) has the molecular formula C16H20F3N5O3 and a molecular weight of 387.36 g/mol. Its IUPAC name is 4-methoxy-7-[(1-methylimidazol-2-yl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-methoxy-7-[(1-methylimidazol-2-yl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155855520 |
| Molecular Formula | C16H20F3N5O3 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 4-methoxy-7-[(1-methylimidazol-2-yl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid |
| SMILES | COc1ncnc2c1CCN(Cc1nccn1C)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H19N5O.C2HF3O2/c1-18-8-5-15-13(18)9-19-6-3-11-12(4-7-19)16-10-17-14(11)20-2;3-2(4,5)1(6)7/h5,8,10H,3-4,6-7,9H2,1-2H3;(H,6,7) |
| InChIKey | BNHIQCCRHHBTSI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |