C24H21F7N4O4 — CID 155840645
4-(4-fluorophenyl)-7-(pyridin-3-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155840645) has the molecular formula C24H21F7N4O4 and a molecular weight of 562.44 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-7-(pyridin-3-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-(4-fluorophenyl)-7-(pyridin-3-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155840645 |
| Molecular Formula | C24H21F7N4O4 |
| Molecular Weight | 562.44 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | 4-(4-fluorophenyl)-7-(pyridin-3-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Fc1ccc(-c2ncnc3c2CCN(Cc2cccnc2)CC3)cc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H19FN4.2C2HF3O2/c21-17-5-3-16(4-6-17)20-18-7-10-25(11-8-19(18)23-14-24-20)13-15-2-1-9-22-12-15;2*3-2(4,5)1(6)7/h1-6,9,12,14H,7-8,10-11,13H2;2*(H,6,7) |
| InChIKey | CBFMUFDSZWFNTC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 116.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |