C22H18F4N4O3 — CID 155842521
[4-(4-fluorophenyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-pyridin-2-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155842521) has the molecular formula C22H18F4N4O3 and a molecular weight of 462.40 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-pyridin-2-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [4-(4-fluorophenyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-pyridin-2-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155842521 |
| Molecular Formula | C22H18F4N4O3 |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | [4-(4-fluorophenyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-pyridin-2-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccccn1)N1CCc2ncnc(-c3ccc(F)cc3)c2CC1 |
| InChI | InChI=1S/C20H17FN4O.C2HF3O2/c21-15-6-4-14(5-7-15)19-16-8-11-25(12-9-17(16)23-13-24-19)20(26)18-3-1-2-10-22-18;3-2(4,5)1(6)7/h1-7,10,13H,8-9,11-12H2;(H,6,7) |
| InChIKey | FTRQMFKLVALEAZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |