C17H17F3N4O3 — CID 118743589
(4-methyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)-pyridin-4-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 118743589) has the molecular formula C17H17F3N4O3 and a molecular weight of 382.34 g/mol. Its IUPAC name is (4-methyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)-pyridin-4-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | (4-methyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)-pyridin-4-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118743589 |
| Molecular Formula | C17H17F3N4O3 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | (4-methyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)-pyridin-4-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ncnc2c1CCN(C(=O)c1ccncc1)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H16N4O.C2HF3O2/c1-11-13-4-8-19(9-5-14(13)18-10-17-11)15(20)12-2-6-16-7-3-12;3-2(4,5)1(6)7/h2-3,6-7,10H,4-5,8-9H2,1H3;(H,6,7) |
| InChIKey | JEXJEFVCYYOHLH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |