C22H25F6N5O5S — CID 171687961
[4-(4-methylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-thiophen-3-ylmethanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171687961) has the molecular formula C22H25F6N5O5S and a molecular weight of 585.53 g/mol. Its IUPAC name is [4-(4-methylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-thiophen-3-ylmethanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [4-(4-methylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-thiophen-3-ylmethanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171687961 |
| Molecular Formula | C22H25F6N5O5S |
| Molecular Weight | 585.53 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | [4-(4-methylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-thiophen-3-ylmethanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN1CCN(c2ncnc3c2CCN(C(=O)c2ccsc2)CC3)CC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H23N5OS.2C2HF3O2/c1-21-7-9-22(10-8-21)17-15-2-5-23(6-3-16(15)19-13-20-17)18(24)14-4-11-25-12-14;2*3-2(4,5)1(6)7/h4,11-13H,2-3,5-10H2,1H3;2*(H,6,7) |
| InChIKey | NMDUYZBSSDCRPI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.53 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |